cas: 401811-77-6 — see every product listed under this CAS number, including other names
tert-Butyl (5-bromobenzo[d][1,3]dioxol-4-yl)carbamate, 95%, 95% (CAS 401811-77-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CAJF-100mg |
| cas | 401811-77-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 726.80 Pln | |
| Chemat | 5g | 2056.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(5-bromo-1,3-benzodioxol-4-yl)carbamate (CAS 401811-77-6) is a chemical compound with the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. IUPAC name: tert-butyl N-(5-bromo-1,3-benzodioxol-4-yl)carbamate. InChIKey: JMDLHOQJZIIQMX-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO4 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-1,3-benzodioxol-4-yl)carbamate |
| InChIKey | JMDLHOQJZIIQMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC2=C1OCO2)Br |
Computed by PubChem (NCBI)