cas: 405939-39-1 — see every product listed under this CAS number, including other names
tert-Butyl (5-bromothiazol-2-yl)carbamate, 97%, 97% (CAS 405939-39-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C6N3-250mg |
| cas | 405939-39-1 |
| size | 250mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 266.00 Pln | |
| Chemat | 50g | 462.80 Pln | |
| Chemat | 100g | 842.00 Pln | |
| Chemat | 250g | 1667.60 Pln | |
| Chemat | 500g | 3052.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate (CAS 405939-39-1) is a chemical compound with the molecular formula C8H11BrN2O2S and a molecular weight of 279.16 g/mol. IUPAC name: tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate. InChIKey: OIBKBVFFZYCBAQ-UHFFFAOYSA-N.
| Molecular formula | C8H11BrN2O2S |
|---|---|
| Molecular weight | 279.16 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-1,3-thiazol-2-yl)carbamate |
| InChIKey | OIBKBVFFZYCBAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(S1)Br |
Computed by PubChem (NCBI)