Products 133728-27-5

CAS 133728-27-5 is the registry number for TERT-BUTYL (9-OXONONYL)CARBAMATE, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(9-oxononyl)carbamate (CAS 133728-27-5) is a chemical compound with the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. IUPAC name: tert-butyl N-(9-oxononyl)carbamate. InChIKey: ORHUSMLNPOLNLC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H27NO3
Molecular weight257.37 g/mol
IUPAC nametert-butyl N-(9-oxononyl)carbamate
InChIKeyORHUSMLNPOLNLC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCCCCCCCC=O

Computed by PubChem (NCBI)