tert-Butyl (R)-2,7-diazaspiro[4.4]nonane-2-carboxylate, 98%
cas: 2201785-36-4 — see every product listed under this CAS number, including other names
tert-Butyl (R)-2,7-diazaspiro[4.4]nonane-2-carboxylate, 98% (CAS 2201785-36-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1380874-100mg |
| cas | 2201785-36-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 420.44 Pln | |
| Ambeed | 250mg | 553.94 Pln | |
| Ambeed | 1g | 1371.62 Pln | |
| Ambeed | 5g | 5643.62 Pln | |
| BLDpharm | 100mg | 414.32 Pln | |
| BLDpharm | 250mg | 586.48 Pln | |
| BLDpharm | 1g | 1475.06 Pln | |
| BLDpharm | 5g | 6079.00 Pln | |
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 612.30 Pln | |
| Fluorochem | 1g | 1497.41 Pln | |
| Fluorochem | 5g | 6058.30 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (5R)-2,7-diazaspiro[4.4]nonane-2-carboxylate (CAS 2201785-36-4) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (5R)-2,7-diazaspiro[4.4]nonane-2-carboxylate. InChIKey: HPPARSNAMZJAPZ-GFCCVEGCSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (5R)-2,7-diazaspiro[4.4]nonane-2-carboxylate |
| InChIKey | HPPARSNAMZJAPZ-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@]2(C1)CCNC2 |
Computed by PubChem (NCBI)