Products 120444-05-5
CAS 120444-05-5 is the registry number for tert-Butyl (S)-2-acetoxypropanoate, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Tert-butyl (2S)-2-acetyloxypropanoate (CAS 120444-05-5) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: tert-butyl (2S)-2-acetyloxypropanoate. InChIKey: PHNMHWJIWPTKNO-LURJTMIESA-N.
| Molecular formula | C9H16O4 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | tert-butyl (2S)-2-acetyloxypropanoate |
| InChIKey | PHNMHWJIWPTKNO-LURJTMIESA-N |
| SMILES | C[C@@H](C(=O)OC(C)(C)C)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl (S)-2-acetoxypropanoate, Propanoic acid, 2-(acetyloxy)-, 1,1-dimethylethyl ester, (2S)-, Tert-butyl (2S)-2-acetyloxypropanoate, Propanoic acid,2-(acetyloxy)-,1,1-dimethylethyl ester,(2S)-, tert-Butyl(S)-2-acetoxypropanoate, tert-butyl (2S)-2-acetoxypropanoate, Propanoic acid, 2-(acetyloxy)-, 1,1-diMethylethyl ester, (2S)-3