cas: 1217753-75-7 — see every product listed under this CAS number, including other names
tert-Butyl (S)-3-aminopiperidine-1-carboxylate hydrochloride, 97% (CAS 1217753-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F601160-100MG |
| cas | 1217753-75-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 560.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S)-3-aminopiperidine-1-carboxylate;hydrochloride (CAS 1217753-75-7) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl (3S)-3-aminopiperidine-1-carboxylate;hydrochloride. InChIKey: DUNAVVRRZJQGCZ-QRPNPIFTSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl (3S)-3-aminopiperidine-1-carboxylate;hydrochloride |
| InChIKey | DUNAVVRRZJQGCZ-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)