tert-Butyl (S)-3-aminopiperidine-1-carboxylate hydrochloride, 97%
cas: 1217753-75-7 — see every product listed under this CAS number, including other names
tert-Butyl (S)-3-aminopiperidine-1-carboxylate hydrochloride, 97% (CAS 1217753-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A845649-100mg |
| cas | 1217753-75-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 580.93 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 323.60 Pln | |
| Chemat | 5g | 1245.20 Pln | |
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 555.03 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (3S)-3-aminopiperidine-1-carboxylate;hydrochloride (CAS 1217753-75-7) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl (3S)-3-aminopiperidine-1-carboxylate;hydrochloride. InChIKey: DUNAVVRRZJQGCZ-QRPNPIFTSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl (3S)-3-aminopiperidine-1-carboxylate;hydrochloride |
| InChIKey | DUNAVVRRZJQGCZ-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl (S)-3-aminopiperidine-1-carboxylate hydrochloride, tert-Butyl (3S)-3-aminopiperidine-1-carboxylate hydrochloride, (S)-1-Boc-3-aminopiperidine hydrochloride, tert-butyl (3S)-3-aminopiperidine-1-carboxylate;hydrochloride, (S)-1-boc-3-Aminopiperidine HCl, tert-Butyl(S)-3-aminopiperidine-1-carboxylatehydrochloride, (R)-3-Amino-piperidine-1-carboxylic acid tert-butyl ester Hydrochlorode