cas: 849616-22-4 — see every product listed under this CAS number, including other names
tert-Butyl (cis-3-aminocyclohexyl)carbamate 98% (CAS 849616-22-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A365760-250mg |
| cas | 849616-22-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 993.38 Pln | |
| Ambeed | 1g | 2261.62 Pln | |
| Ambeed | 5g | 6750.56 Pln | |
| Ambeed | 10g | 11245.06 Pln | |
| Ambeed | 100mg | 832.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A365760 |
Tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate (CAS 849616-22-4) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate. InChIKey: OBSACSBMTRJNPH-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate |
| InChIKey | OBSACSBMTRJNPH-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H](C1)N |
Computed by PubChem (NCBI)