cas: 849616-22-4 — see every product listed under this CAS number, including other names
tert-butyl rac-[(1R,3S)-3-aminocyclohexyl]carbamate hydrochloride, 97% (CAS 849616-22-4) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F476703-25MG |
| cas | 849616-22-4 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 482.14 Pln | |
| Fluorochem | 100mg | 857.01 Pln | |
| Fluorochem | 250mg | 1299.56 Pln | |
| Fluorochem | 1g | 2538.71 Pln | |
| Fluorochem | 5g | 7453.64 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate (CAS 849616-22-4) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate. InChIKey: OBSACSBMTRJNPH-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate |
| InChIKey | OBSACSBMTRJNPH-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H](C1)N |
Computed by PubChem (NCBI)