cas: 1188263-69-5 — see every product listed under this CAS number, including other names
tert-Butyl (pyrrolidin-3-ylmethyl)carbamatehydrochloride, 95% (CAS 1188263-69-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211624-1G |
| cas | 1188263-69-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 888.25 Pln | |
| Fluorochem | 10g | 1716.08 Pln | |
| Fluorochem | 25g | 3533.15 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(pyrrolidin-3-ylmethyl)carbamate;hydrochloride (CAS 1188263-69-5) is a chemical compound with the molecular formula C10H21ClN2O2 and a molecular weight of 236.74 g/mol. IUPAC name: tert-butyl N-(pyrrolidin-3-ylmethyl)carbamate;hydrochloride. InChIKey: WEUDEPABMRKFFT-UHFFFAOYSA-N.
| Molecular formula | C10H21ClN2O2 |
|---|---|
| Molecular weight | 236.74 g/mol |
| IUPAC name | tert-butyl N-(pyrrolidin-3-ylmethyl)carbamate;hydrochloride |
| InChIKey | WEUDEPABMRKFFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCNC1.Cl |
Computed by PubChem (NCBI)