tert-Butyl (tosylmethyl)carbamate, 95%
cas: 433335-00-3 — see every product listed under this CAS number, including other names
tert-Butyl (tosylmethyl)carbamate, 95% (CAS 433335-00-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A672629-250mg |
| cas | 433335-00-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1544.06 Pln | |
| Ambeed | 10g | 2656.56 Pln | |
| Ambeed | 25g | 5243.12 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 1130.00 Pln | |
| Chemat | 10g | 1926.80 Pln | |
| Chemat | 25g | 3794.00 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 436.54 Pln | |
| BLDpharm | 5g | 1663.88 Pln | |
| BLDpharm | 10g | 2857.91 Pln | |
| BLDpharm | 25g | 5651.37 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-[(4-methylphenyl)sulfonylmethyl]carbamate (CAS 433335-00-3) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: tert-butyl N-[(4-methylphenyl)sulfonylmethyl]carbamate. InChIKey: WJECUHBEAHRZPC-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | tert-butyl N-[(4-methylphenyl)sulfonylmethyl]carbamate |
| InChIKey | WJECUHBEAHRZPC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
N-Boc-(tosyl)methylamine, tert-Butyl (tosylmethyl)carbamate, Tert-butyl N-[(4-methylphenyl)sulfonylmethyl]carbamate, tert-Butyl tosylmethylcarbamate, N-Boc-(p-tosyl)methanamine, N-Boc-1-tosylmethanamine, N-Boc-(tosyl)methylamine 97%, tert-Butyl(tosylmethyl)carbamate, (Toluene-4-sulfonylmethyl)carbamic acid, tert-butyl ester, N-Boc-(p-tosyl)methanamine,tert-Butyl tosylmethylcarbamate