CAS 433335-00-3 appears in our catalog under these names: N-Boc-(tosyl)methylamine, 95%, tert-Butyl (tosylmethyl)carbamate, 95%, 95%, TERT-BUTYL N-[(4-METHYLBENZENESULFONYL)METHYL]CARBAMATE, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
Tert-butyl N-[(4-methylphenyl)sulfonylmethyl]carbamate (CAS 433335-00-3) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: tert-butyl N-[(4-methylphenyl)sulfonylmethyl]carbamate. InChIKey: WJECUHBEAHRZPC-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | tert-butyl N-[(4-methylphenyl)sulfonylmethyl]carbamate |
| InChIKey | WJECUHBEAHRZPC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)CNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)