cas: 400898-92-2 — see every product listed under this CAS number, including other names
tert-Butyl (trans-4-(methoxy(methyl)carbamoyl)cyclohexyl)carbamate 98% (CAS 400898-92-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A660544-250mg |
| cas | 400898-92-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1638.62 Pln | |
| Ambeed | 25g | 6355.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A660544 |
Tert-butyl N-[4-[methoxy(methyl)carbamoyl]cyclohexyl]carbamate (CAS 400898-92-2) is a chemical compound with the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. IUPAC name: tert-butyl N-[4-[methoxy(methyl)carbamoyl]cyclohexyl]carbamate. InChIKey: VCYMEIIREZLGFN-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O4 |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | tert-butyl N-[4-[methoxy(methyl)carbamoyl]cyclohexyl]carbamate |
| InChIKey | VCYMEIIREZLGFN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(CC1)C(=O)N(C)OC |
Computed by PubChem (NCBI)