cas: 1202800-68-7 — see every product listed under this CAS number, including other names
tert-Butyl 1,4,6,7-tetrahydro-5H-imidazo[4,5-c]pyridine-5-carboxylate 97% (CAS 1202800-68-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A728852-100mg |
| cas | 1202800-68-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 1171.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A728852 |
Tert-butyl 3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate (CAS 1202800-68-7) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl 3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate. InChIKey: DGOLMFKQDDOSPK-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl 3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxylate |
| InChIKey | DGOLMFKQDDOSPK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)NC=N2 |
Computed by PubChem (NCBI)