cas: 1032158-48-7 — see every product listed under this CAS number, including other names
tert-Butyl 1-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate 98% (CAS 1032158-48-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A216655-100mg |
| cas | 1032158-48-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1182.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A216655 |
Tert-butyl 3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate (CAS 1032158-48-7) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl 3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate. InChIKey: LQQAOPZWMYAJSP-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl 3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| InChIKey | LQQAOPZWMYAJSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CNC2=O |
Computed by PubChem (NCBI)