cas: 845267-78-9 — see every product listed under this CAS number, including other names
tert-Butyl 2,4-dioxopiperidine-1-carboxylate, 97% (CAS 845267-78-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A325155-1g |
| cas | 845267-78-9 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 10g | 170.12 Pln | |
| Ambeed | 25g | 275.81 Pln | |
| Ambeed | 100g | 592.88 Pln | |
| Ambeed | 500g | 2684.38 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 10g | 219.95 Pln | |
| BLDpharm | 25g | 292.14 Pln | |
| BLDpharm | 100g | 636.47 Pln | |
| BLDpharm | 500g | 2891.23 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 2,4-dioxopiperidine-1-carboxylate (CAS 845267-78-9) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: tert-butyl 2,4-dioxopiperidine-1-carboxylate. InChIKey: SLCAHLSQXDNQSF-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | tert-butyl 2,4-dioxopiperidine-1-carboxylate |
| InChIKey | SLCAHLSQXDNQSF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)CC1=O |
Computed by PubChem (NCBI)