CAS 845267-78-9 appears in our catalog under these names: 2,4-Dioxo-piperidine-1-carboxylic acid tert-butyl ester, tert-Butyl 2,4-dioxopiperidine-1-carboxylate 97%, TERT-BUTYL 2,4-DIOXOPIPERIDINE-1-CARBOXYLATE, 97%, 97%, 1-Boc-Piperidine-2,4-dione, 95%. Offered by: Triz Pharma-Tech, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 1g, 5g, 10g, 25g, 100g, 500g, 50g.
Tert-butyl 2,4-dioxopiperidine-1-carboxylate (CAS 845267-78-9) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: tert-butyl 2,4-dioxopiperidine-1-carboxylate. InChIKey: SLCAHLSQXDNQSF-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | tert-butyl 2,4-dioxopiperidine-1-carboxylate |
| InChIKey | SLCAHLSQXDNQSF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)CC1=O |
Computed by PubChem (NCBI)