cas: 1228675-18-0 — see every product listed under this CAS number, including other names
tert-Butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate, 98%, 98% (CAS 1228675-18-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AVW-100mg |
| cas | 1228675-18-0 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 419.60 Pln | |
| Chemat | 5g | 1096.40 Pln | |
| Chemat | 10g | 1782.80 Pln | |
| Chemat | 25g | 3506.00 Pln | |
| Chemat | 50g | 5229.20 Pln | |
| Chemat | 100g | 8915.60 Pln | |
| Chemat | 250g | 18146.00 Pln | |
| Chemat | 500g | 30398.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate (CAS 1228675-18-0) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate. InChIKey: MALCQJIQWIWGOV-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate |
| InChIKey | MALCQJIQWIWGOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC2C1C2 |
Computed by PubChem (NCBI)