cas: 769968-18-5 — see every product listed under this CAS number, including other names
tert-Butyl 2-(3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetate, 95-<97% (CAS 769968-18-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC914-95-97-1g |
| cas | 769968-18-5 |
| size | 1g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 1g | 3765.96 Pln | |
| Hoffman Fine Chemicals | 2,5g | 6362.62 Pln | |
| Hoffman Fine Chemicals | 5g | 9967.32 Pln | |
| Hoffman Fine Chemicals | 10g | 15766.74 Pln | |
| Hoffman Fine Chemicals | 25g | 33158.62 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Tert-butyl 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate (CAS 769968-18-5) is a chemical compound with the molecular formula C18H27BO5 and a molecular weight of 334.2 g/mol. IUPAC name: tert-butyl 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate. InChIKey: MOOZLSQYGNTKMD-UHFFFAOYSA-N.
| Molecular formula | C18H27BO5 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | tert-butyl 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate |
| InChIKey | MOOZLSQYGNTKMD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)