cas: 769968-17-4 — see every product listed under this CAS number, including other names
tert-Butyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)acetate, 95%, 95% (CAS 769968-17-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTQF-100mg |
| cas | 769968-17-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1182.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate (CAS 769968-17-4) is a chemical compound with the molecular formula C18H27BO5 and a molecular weight of 334.2 g/mol. IUPAC name: tert-butyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate. InChIKey: FFPZRWCEAZXEDG-UHFFFAOYSA-N.
| Molecular formula | C18H27BO5 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | tert-butyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate |
| InChIKey | FFPZRWCEAZXEDG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)