cas: 263403-72-1 — see every product listed under this CAS number, including other names
tert-Butyl 2-Boc-aminobenzylcarbamate 95% (CAS 263403-72-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208150-1g |
| cas | 263403-72-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 1722.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A208150 |
Tert-butyl N-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]carbamate (CAS 263403-72-1) is a chemical compound with the molecular formula C17H26N2O4 and a molecular weight of 322.4 g/mol. IUPAC name: tert-butyl N-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]carbamate. InChIKey: NZJDCDLBHCNBMR-UHFFFAOYSA-N.
| Molecular formula | C17H26N2O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | tert-butyl N-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]carbamate |
| InChIKey | NZJDCDLBHCNBMR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=CC=C1NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)