Products 178049-55-3

CAS 178049-55-3 is the registry number for N-(3-Methoxypropyl) L-Z-Valinamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S)-1-(3-methoxypropylamino)-3-methyl-1-oxobutan-2-yl]carbamate (CAS 178049-55-3) is a chemical compound with the molecular formula C17H26N2O4 and a molecular weight of 322.4 g/mol. IUPAC name: benzyl N-[(2S)-1-(3-methoxypropylamino)-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: WKWKADJQUULNFK-HNNXBMFYSA-N.

Identity
Molecular formulaC17H26N2O4
Molecular weight322.4 g/mol
IUPAC namebenzyl N-[(2S)-1-(3-methoxypropylamino)-3-methyl-1-oxobutan-2-yl]carbamate
InChIKeyWKWKADJQUULNFK-HNNXBMFYSA-N
SMILESCC(C)[C@@H](C(=O)NCCCOC)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)