CAS 441019-91-6 appears in our catalog under these names: Acebutolol EP Impurity I HCl, Acebutolol EP Impurity I, Acebutolol Impurity 9(Acebutolol EP Impurity I), rac N-Desisopropyl-N-ethyl Acebutolol, rac-N-Desisopropyl-N-ethyl acebutolol. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 5mg.
N-[3-acetyl-4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]butanamide (CAS 441019-91-6) is a chemical compound with the molecular formula C17H26N2O4 and a molecular weight of 322.4 g/mol. IUPAC name: N-[3-acetyl-4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]butanamide. InChIKey: BKGQPZMMLAGZCQ-UHFFFAOYSA-N.
| Molecular formula | C17H26N2O4 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | N-[3-acetyl-4-[3-(ethylamino)-2-hydroxypropoxy]phenyl]butanamide |
| InChIKey | BKGQPZMMLAGZCQ-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=CC(=C(C=C1)OCC(CNCC)O)C(=O)C |
Computed by PubChem (NCBI)