cas: 365996-62-9 — see every product listed under this CAS number, including other names
tert-Butyl 2-amino-4H-pyrrolo[3,4-d]thiazole-5(6H)-carboxylate, 98%, 98% (CAS 365996-62-9) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I803-50g |
| cas | 365996-62-9 |
| size | 50g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 6146.00 Pln | |
| Chemat | 100g | 9798.80 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2406.80 Pln | |
| Chemat | 25g | 4610.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-amino-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-5-carboxylate (CAS 365996-62-9) is a chemical compound with the molecular formula C10H15N3O2S and a molecular weight of 241.31 g/mol. IUPAC name: tert-butyl 2-amino-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-5-carboxylate. InChIKey: QRJZLNBRXQAKCP-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O2S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | tert-butyl 2-amino-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-5-carboxylate |
| InChIKey | QRJZLNBRXQAKCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1)SC(=N2)N |
Computed by PubChem (NCBI)