cas: 869198-95-8 — see every product listed under this CAS number, including other names
tert-Butyl 2-amino-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate 95% (CAS 869198-95-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100453-250mg |
| cas | 869198-95-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 492.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A100453 |
Tert-butyl 2-amino-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate (CAS 869198-95-8) is a chemical compound with the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. IUPAC name: tert-butyl 2-amino-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate. InChIKey: PGNLVGKPNUNOJE-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O2 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | tert-butyl 2-amino-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine-6-carboxylate |
| InChIKey | PGNLVGKPNUNOJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=NC(=NC=C2C1)N |
Computed by PubChem (NCBI)