cas: 1638768-92-9 — see every product listed under this CAS number, including other names
tert-Butyl 2-azaspiro[3.4]oct-6-ene-2-carboxylate 95% (CAS 1638768-92-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A328308-100mg |
| cas | 1638768-92-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 526.12 Pln | |
| Ambeed | 1g | 1210.31 Pln | |
| Ambeed | 5g | 3513.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A328308 |
Tert-butyl 2-azaspiro[3.4]oct-6-ene-2-carboxylate (CAS 1638768-92-9) is a chemical compound with the molecular formula C12H19NO2 and a molecular weight of 209.28 g/mol. IUPAC name: tert-butyl 2-azaspiro[3.4]oct-6-ene-2-carboxylate. InChIKey: FCJJOVIWSSZKBW-UHFFFAOYSA-N.
| Molecular formula | C12H19NO2 |
|---|---|
| Molecular weight | 209.28 g/mol |
| IUPAC name | tert-butyl 2-azaspiro[3.4]oct-6-ene-2-carboxylate |
| InChIKey | FCJJOVIWSSZKBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC=CC2 |
Computed by PubChem (NCBI)