cas: 301226-27-7 — see every product listed under this CAS number, including other names
tert-Butyl 2-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate, 97% (CAS 301226-27-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215026-250MG |
| cas | 301226-27-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1544.27 Pln | |
| Fluorochem | 10g | 2783.41 Pln | |
| Fluorochem | 25g | 6875.72 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (CAS 301226-27-7) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: tert-butyl 2-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate. InChIKey: DXCDANAWBPYOAA-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | tert-butyl 2-oxo-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| InChIKey | DXCDANAWBPYOAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(=O)O2)CC1 |
Computed by PubChem (NCBI)