cas: 1251001-73-6 — see every product listed under this CAS number, including other names
tert-Butyl 2-oxospiro[1H-indole-3,3'-azetidine]-1'-carboxylate, 97% (CAS 1251001-73-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609081-100MG |
| cas | 1251001-73-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 2361.69 Pln | |
| Fluorochem | 250mg | 3725.79 Pln | |
| Fluorochem | 500mg | 6167.64 Pln | |
| Fluorochem | 1g | 9203.03 Pln | |
| Fluorochem | 5g | 27477.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-oxospiro[1H-indole-3,3'-azetidine]-1'-carboxylate (CAS 1251001-73-6) is a chemical compound with the molecular formula C15H18N2O3 and a molecular weight of 274.31 g/mol. IUPAC name: tert-butyl 2-oxospiro[1H-indole-3,3'-azetidine]-1'-carboxylate. InChIKey: KNXROXDVJNVTCE-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O3 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | tert-butyl 2-oxospiro[1H-indole-3,3'-azetidine]-1'-carboxylate |
| InChIKey | KNXROXDVJNVTCE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)