cas: 1393845-78-7 — see every product listed under this CAS number, including other names
tert-Butyl 2H,4H,5H,6H,7H-pyrazolo[4,3-b]pyridine-4-carboxylate 98% (CAS 1393845-78-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A542387-100mg |
| cas | 1393845-78-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| Ambeed | 5g | 4597.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A542387 |
Tert-butyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate (CAS 1393845-78-7) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate. InChIKey: VUEOIIWQDOZFFL-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate |
| InChIKey | VUEOIIWQDOZFFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1C=NN2 |
Computed by PubChem (NCBI)