cas: 1393845-78-7 — see every product listed under this CAS number, including other names
tert-Butyl 6,7-dihydro-2H-pyrazolo[4,3-b]pyridine-4(5H)-carboxylate, 98%, 98% (CAS 1393845-78-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112AW4-100mg |
| cas | 1393845-78-7 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate (CAS 1393845-78-7) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate. InChIKey: VUEOIIWQDOZFFL-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate |
| InChIKey | VUEOIIWQDOZFFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC2=C1C=NN2 |
Computed by PubChem (NCBI)