tert-Butyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate, 98%
cas: 1303974-47-1 — see every product listed under this CAS number, including other names
tert-Butyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate, 98% (CAS 1303974-47-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A370727-100mg |
| cas | 1303974-47-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 559.50 Pln | |
| Ambeed | 1g | 1399.44 Pln | |
| Ambeed | 5g | 5827.19 Pln | |
| Ambeed | 10g | 7902.00 Pln | |
| Ambeed | 25g | 13297.62 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 603.15 Pln | |
| BLDpharm | 1g | 1369.54 Pln | |
| BLDpharm | 5g | 5712.46 Pln | |
| BLDpharm | 10g | 8517.03 Pln | |
| BLDpharm | 25g | 14337.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate (CAS 1303974-47-1) is a chemical compound with the molecular formula C11H19F2NO3 and a molecular weight of 251.27 g/mol. IUPAC name: tert-butyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: GBFXSKJJISVIRA-UHFFFAOYSA-N.
| Molecular formula | C11H19F2NO3 |
|---|---|
| Molecular weight | 251.27 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | GBFXSKJJISVIRA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)(F)F)CO |
Computed by PubChem (NCBI)