cas: 1251015-63-0 — see every product listed under this CAS number, including other names
tert-Butyl 3,9-diazabicyclo[4.2.1]nonane-9-carboxylate, 97% (CAS 1251015-63-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QM-7573-250mg |
| cas | 1251015-63-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 872.63 Pln | |
| Fluorochem | 500mg | 1205.84 Pln | |
| Fluorochem | 1g | 1695.25 Pln | |
| Fluorochem | 5g | 5438.73 Pln | |
| Fluorochem | 10g | 9192.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl 3,9-diazabicyclo[4.2.1]nonane-9-carboxylate (CAS 1251015-63-0) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl 3,9-diazabicyclo[4.2.1]nonane-9-carboxylate. InChIKey: IDJDDPDWYRVJPF-UHFFFAOYSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl 3,9-diazabicyclo[4.2.1]nonane-9-carboxylate |
| InChIKey | IDJDDPDWYRVJPF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CNCC2 |
Computed by PubChem (NCBI)