cas: 141699-56-1 — see every product listed under this CAS number, including other names
tert-Butyl 3-(((methylsulfonyl)oxy)methyl)pyrrolidine-1-carboxylate 98+% (CAS 141699-56-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A517005-100mg |
| cas | 141699-56-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 804.25 Pln | |
| Ambeed | 5g | 2350.62 Pln | |
| Ambeed | 10g | 4052.75 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A517005 |
Tert-butyl 3-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate (CAS 141699-56-1) is a chemical compound with the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl 3-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate. InChIKey: XFRHYGNZDGDQST-UHFFFAOYSA-N.
| Molecular formula | C11H21NO5S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl 3-(methylsulfonyloxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | XFRHYGNZDGDQST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)COS(=O)(=O)C |
Computed by PubChem (NCBI)