cas: 157327-42-9 — see every product listed under this CAS number, including other names
tert-Butyl 3-((dimethylamino)methylene)-4-oxopyrrolidine-1-carboxylate, 97% (CAS 157327-42-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F325880-250MG |
| cas | 157327-42-9 |
| size | 250mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 242.64 Pln | |
| Fluorochem | 10g | 430.07 Pln | |
| Fluorochem | 25g | 992.38 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 10g | 437.12 Pln | |
| Ambeed | 25g | 982.25 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl (3E)-3-(dimethylaminomethylidene)-4-oxopyrrolidine-1-carboxylate (CAS 157327-42-9) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl (3E)-3-(dimethylaminomethylidene)-4-oxopyrrolidine-1-carboxylate. InChIKey: NICVZJAVRBPUME-RMKNXTFCSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl (3E)-3-(dimethylaminomethylidene)-4-oxopyrrolidine-1-carboxylate |
| InChIKey | NICVZJAVRBPUME-RMKNXTFCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C/C(=C\N(C)C)/C(=O)C1 |
Computed by PubChem (NCBI)