cas: 1807521-09-0 — see every product listed under this CAS number, including other names
tert-Butyl 3-(2-(2-(4-formylbenzamido)ethoxy)ethoxy)propanoate, 97%, 97% (CAS 1807521-09-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I194-100mg |
| cas | 1807521-09-0 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1139.60 Pln | |
| Chemat | 250mg | 2070.80 Pln | |
| Chemat | 1g | 5733.20 Pln | |
| Chemat | 25mg | 438.80 Pln | |
| Chemat | 50mg | 698.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate (CAS 1807521-09-0) is a chemical compound with the molecular formula C19H27NO6 and a molecular weight of 365.4 g/mol. IUPAC name: tert-butyl 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate. InChIKey: UXMPBIQFYCJYBB-UHFFFAOYSA-N.
| Molecular formula | C19H27NO6 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[(4-formylbenzoyl)amino]ethoxy]ethoxy]propanoate |
| InChIKey | UXMPBIQFYCJYBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCNC(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)