cas: 914672-66-5 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-carboxylate, 96% (CAS 914672-66-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F451092-250MG |
| cas | 914672-66-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 419.66 Pln | |
| Fluorochem | 2g | 789.32 Pln | |
| Fluorochem | 5g | 1221.46 Pln | |
| Fluorochem | 10g | 2346.07 Pln | |
| Fluorochem | 25g | 4662.96 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate (CAS 914672-66-5) is a chemical compound with the molecular formula C14H23BN2O4 and a molecular weight of 294.16 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate. InChIKey: AGQGGUKSXYRZFJ-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O4 |
|---|---|
| Molecular weight | 294.16 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
| InChIKey | AGQGGUKSXYRZFJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)