cas: 914672-66-5 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-carboxylate, 98%, 98% (CAS 914672-66-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GTGJ-50mg |
| cas | 914672-66-5 |
| size | 50mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 93.20 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1427.60 Pln | |
| Chemat | 25g | 2776.40 Pln | |
| Chemat | 100g | 7720.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate (CAS 914672-66-5) is a chemical compound with the molecular formula C14H23BN2O4 and a molecular weight of 294.16 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate. InChIKey: AGQGGUKSXYRZFJ-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O4 |
|---|---|
| Molecular weight | 294.16 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
| InChIKey | AGQGGUKSXYRZFJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=NN(C=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)