cas: 935278-73-2 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrole-1-carboxylate, 98%, 98% (CAS 935278-73-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UJI-100mg |
| cas | 935278-73-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 582.80 Pln | |
| Chemat | 5g | 1874.00 Pln | |
| Chemat | 10g | 3664.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate (CAS 935278-73-2) is a chemical compound with the molecular formula C15H24BNO4 and a molecular weight of 293.17 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate. InChIKey: STSRFVDSYZQVNM-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO4 |
|---|---|
| Molecular weight | 293.17 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1-carboxylate |
| InChIKey | STSRFVDSYZQVNM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)