cas: 903895-48-7 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97% (CAS 903895-48-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 15g, 25g, 100g, 250mg, 1g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F461737-5G |
| cas | 903895-48-7 |
| size | 5g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 247.85 Pln | |
| Fluorochem | 15g | 341.56 Pln | |
| Fluorochem | 25g | 523.79 Pln | |
| Fluorochem | 100g | 1809.80 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 259.12 Pln | |
| Ambeed | 25g | 542.81 Pln | |
| Ambeed | 100g | 1761.00 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 903895-48-7) is a chemical compound with the molecular formula C17H25BO4 and a molecular weight of 304.2 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: VOLNBIZKQGSQMP-UHFFFAOYSA-N.
| Molecular formula | C17H25BO4 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | VOLNBIZKQGSQMP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)