cas: 1312712-22-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate 98% (CAS 1312712-22-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A571685-100g |
| cas | 1312712-22-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 15823.00 Pln | |
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1277.06 Pln | |
| Ambeed | 25g | 4992.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A571685 |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate (CAS 1312712-22-3) is a chemical compound with the molecular formula C15H28BNO4 and a molecular weight of 297.20 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate. InChIKey: YADHEMOTVPFRIU-UHFFFAOYSA-N.
| Molecular formula | C15H28BNO4 |
|---|---|
| Molecular weight | 297.20 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate |
| InChIKey | YADHEMOTVPFRIU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)