cas: 1312712-22-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate, 97%, 97% (CAS 1312712-22-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111VU0-100mg |
| cas | 1312712-22-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 500mg | 146.00 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 1062.80 Pln | |
| Chemat | 25g | 2334.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate (CAS 1312712-22-3) is a chemical compound with the molecular formula C15H28BNO4 and a molecular weight of 297.20 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate. InChIKey: YADHEMOTVPFRIU-UHFFFAOYSA-N.
| Molecular formula | C15H28BNO4 |
|---|---|
| Molecular weight | 297.20 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate |
| InChIKey | YADHEMOTVPFRIU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)