cas: 1312712-22-3 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate, 97% (CAS 1312712-22-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213062-100MG |
| cas | 1312712-22-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 500mg | 247.85 Pln | |
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 1205.84 Pln | |
| Fluorochem | 25g | 4918.08 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate (CAS 1312712-22-3) is a chemical compound with the molecular formula C15H28BNO4 and a molecular weight of 297.20 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate. InChIKey: YADHEMOTVPFRIU-UHFFFAOYSA-N.
| Molecular formula | C15H28BNO4 |
|---|---|
| Molecular weight | 297.20 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolidine-1-carboxylate |
| InChIKey | YADHEMOTVPFRIU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)