cas: 2270911-31-2 — see every product listed under this CAS number, including other names
tert-Butyl 3-(4-chloro-2-formylphenoxy)azetidine-1-carboxylate 98% (CAS 2270911-31-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1725226-25mg |
| cas | 2270911-31-2 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 426.00 Pln | |
| Ambeed | 50mg | 665.19 Pln | |
| Ambeed | 100mg | 1087.94 Pln | |
| Ambeed | 250mg | 1888.94 Pln | |
| Ambeed | 1g | 4970.56 Pln | |
| Ambeed | 5g | 9876.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1725226 |
Tert-butyl 3-(4-chloro-2-formylphenoxy)azetidine-1-carboxylate (CAS 2270911-31-2) is a chemical compound with the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. IUPAC name: tert-butyl 3-(4-chloro-2-formylphenoxy)azetidine-1-carboxylate. InChIKey: HLQOMXCATMBAPS-UHFFFAOYSA-N.
| Molecular formula | C15H18ClNO4 |
|---|---|
| Molecular weight | 311.76 g/mol |
| IUPAC name | tert-butyl 3-(4-chloro-2-formylphenoxy)azetidine-1-carboxylate |
| InChIKey | HLQOMXCATMBAPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)OC2=C(C=C(C=C2)Cl)C=O |
Computed by PubChem (NCBI)