cas: 1308384-31-7 — see every product listed under this CAS number, including other names
tert-Butyl 3-(aminomethyl)-3-hydroxypiperidine-1-carboxylate, 97%, 97% (CAS 1308384-31-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UZY-100mg |
| cas | 1308384-31-7 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 1835.60 Pln | |
| Chemat | 10g | 3131.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(aminomethyl)-3-hydroxypiperidine-1-carboxylate (CAS 1308384-31-7) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl 3-(aminomethyl)-3-hydroxypiperidine-1-carboxylate. InChIKey: RXAPIVVEFHXCTQ-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl 3-(aminomethyl)-3-hydroxypiperidine-1-carboxylate |
| InChIKey | RXAPIVVEFHXCTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)(CN)O |
Computed by PubChem (NCBI)