cas: 1308384-31-7 — see every product listed under this CAS number, including other names
tert-butyl 3-(aminomethyl)-3-hydroxy-1-piperidinecarboxylate, 95% (CAS 1308384-31-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F312377-100MG |
| cas | 1308384-31-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 622.72 Pln | |
| Fluorochem | 5g | 2444.99 Pln | |
| Fluorochem | 10g | 4189.17 Pln | |
| Fluorochem | 25g | 9234.27 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-(aminomethyl)-3-hydroxypiperidine-1-carboxylate (CAS 1308384-31-7) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl 3-(aminomethyl)-3-hydroxypiperidine-1-carboxylate. InChIKey: RXAPIVVEFHXCTQ-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl 3-(aminomethyl)-3-hydroxypiperidine-1-carboxylate |
| InChIKey | RXAPIVVEFHXCTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)(CN)O |
Computed by PubChem (NCBI)