cas: 102638-45-9 — see every product listed under this CAS number, including other names
tert-Butyl 3-(aminomethyl)benzoate 95% (CAS 102638-45-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A554040-100mg |
| cas | 102638-45-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1494.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A554040 |
Tert-butyl 3-(aminomethyl)benzoate (CAS 102638-45-9) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl 3-(aminomethyl)benzoate. InChIKey: HALKLPHYNWBHPB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl 3-(aminomethyl)benzoate |
| InChIKey | HALKLPHYNWBHPB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)CN |
Computed by PubChem (NCBI)