tert-Butyl 3-acetylbenzoate, 95%
cas: 317829-73-5 — see every product listed under this CAS number, including other names
tert-Butyl 3-acetylbenzoate, 95% (CAS 317829-73-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A124740-100mg |
| cas | 317829-73-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 687.44 Pln | |
| Ambeed | 1g | 1227.00 Pln | |
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1312.40 Pln | |
| BLDpharm | 100mg | 519.84 Pln | |
| BLDpharm | 250mg | 736.43 Pln | |
| BLDpharm | 1g | 1319.56 Pln | |
| Fluorochem | 250mg | 1039.24 Pln | |
| Fluorochem | 1g | 2434.58 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 3-acetylbenzoate (CAS 317829-73-5) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: tert-butyl 3-acetylbenzoate. InChIKey: YESSMNWGVXXGJB-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | tert-butyl 3-acetylbenzoate |
| InChIKey | YESSMNWGVXXGJB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)