cas: 1262411-27-7 — see every product listed under this CAS number, including other names
tert-Butyl 3-amino-3-(hydroxymethyl)azetidine-1-carboxylate 95% (CAS 1262411-27-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A304329-50mg |
| cas | 1262411-27-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 342.56 Pln | |
| Ambeed | 100mg | 609.56 Pln | |
| Ambeed | 250mg | 1076.81 Pln | |
| Ambeed | 1g | 2584.25 Pln | |
| Ambeed | 5g | 6550.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A304329 |
Tert-butyl 3-amino-3-(hydroxymethyl)azetidine-1-carboxylate (CAS 1262411-27-7) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl 3-amino-3-(hydroxymethyl)azetidine-1-carboxylate. InChIKey: JWVHLOXEHDYSLW-UHFFFAOYSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl 3-amino-3-(hydroxymethyl)azetidine-1-carboxylate |
| InChIKey | JWVHLOXEHDYSLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(CO)N |
Computed by PubChem (NCBI)