cas: 923004-82-4 — see every product listed under this CAS number, including other names
tert-Butyl 3-amino-3-cyanopiperidine-1-carboxylate, 97% (CAS 923004-82-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A261296-5g |
| cas | 923004-82-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15811.18 Pln | |
| Fluorochem | 100mg | 1205.84 Pln | |
| Fluorochem | 250mg | 1580.71 Pln | |
| Fluorochem | 500mg | 2575.15 Pln | |
| Fluorochem | 1g | 3829.92 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 3-amino-3-cyanopiperidine-1-carboxylate (CAS 923004-82-4) is a chemical compound with the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. IUPAC name: tert-butyl 3-amino-3-cyanopiperidine-1-carboxylate. InChIKey: IKNNCAWTKRMFSG-UHFFFAOYSA-N.
| Molecular formula | C11H19N3O2 |
|---|---|
| Molecular weight | 225.29 g/mol |
| IUPAC name | tert-butyl 3-amino-3-cyanopiperidine-1-carboxylate |
| InChIKey | IKNNCAWTKRMFSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)(C#N)N |
Computed by PubChem (NCBI)