cas: 149771-43-7 — see every product listed under this CAS number, including other names
tert-Butyl 3-benzyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate 97% (CAS 149771-43-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A323774-250mg |
| cas | 149771-43-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 971.12 Pln | |
| Ambeed | 10g | 1683.12 Pln | |
| Ambeed | 25g | 2984.75 Pln | |
| Ambeed | 100g | 10427.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A323774 |
Tert-butyl 3-benzyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 149771-43-7) is a chemical compound with the molecular formula C18H26N2O2 and a molecular weight of 302.4 g/mol. IUPAC name: tert-butyl 3-benzyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: IOPMFGUNMBWHIS-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | tert-butyl 3-benzyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | IOPMFGUNMBWHIS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)