cas: 149771-43-7 — see every product listed under this CAS number, including other names
tert-Butyl 3-benzyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate, 97%, 97% (CAS 149771-43-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112M1F-100mg |
| cas | 149771-43-7 |
| size | 100mg |
| availability | 34g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 707.60 Pln | |
| Chemat | 10g | 1173.20 Pln | |
| Chemat | 25g | 2200.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-benzyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 149771-43-7) is a chemical compound with the molecular formula C18H26N2O2 and a molecular weight of 302.4 g/mol. IUPAC name: tert-butyl 3-benzyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: IOPMFGUNMBWHIS-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | tert-butyl 3-benzyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | IOPMFGUNMBWHIS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)